Powdr Urolithin B.

Tachwedd 9, 2020

BS Urolithinpecifications

Enw: Urolithin B.
Enw'r Cemegol: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-un
CAS: 1139-83 9-
Fformiwla Cemegol: C13H8O3
Pwysau Moleciwlaidd: X
Lliw:  Powdr gwyn
Allwedd InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Cod SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Swyddogaeth: Gall Urolithin B wella swyddogaeth mitochondrial a chyhyrau.

Gall Urolithin B wella cryfder a dygnwch cyhyrau wrth heneiddio.

cais: Mae Urolithin B yn metabolyn microbaidd berfeddol o ellagitannis ac mae'n arddangos gweithgareddau gwrth-ocsidydd a pro-ocsidydd cryf yn dibynnu ar y system a'r amodau assay. Gall Urolithin B hefyd arddangos gweithgaredd estrogenig a / neu wrth-estrogenig.
Diddymu: Hydawdd hydawdd mewn N, N-dimethylformamide a dimethylmethylene. Sylffon, ychydig yn hydawdd mewn methanol, ethanol, ac asetad ethyl
Temp Storio: Rhewgell Hygrosgopig, -20 ° C, Dan awyrgylch anadweithiol
Cyflwr Llongau: Wedi'i gludo dan dymheredd amgylchynol fel cemegol nad yw'n beryglus. Mae'r cynnyrch hwn yn ddigon sefydlog am ychydig wythnosau yn ystod y llongau cyffredin a'r amser a dreulir yn y Tollau.

 

Urolithin B. Sbectrwm NMR

Urolithin B (1139-83-9) - Sbectrwm NMR

 

Os oes angen COA, MSDS, HNMR arnoch ar gyfer pob swp o gynnyrch a gwybodaeth arall, cysylltwch â'n rheolwr marchnata.